CAS 849343-38-0 is the registry number for 5-Bromo-4-oxo-4H-1-benzopyran-3-carboxaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-bromo-4-oxochromene-3-carbaldehyde (CAS 849343-38-0) is a chemical compound with the molecular formula C10H5BrO3 and a molecular weight of 253.05 g/mol. IUPAC name: 5-bromo-4-oxochromene-3-carbaldehyde. InChIKey: CGVXSNLTRYHWLU-UHFFFAOYSA-N.
| Molecular formula | C10H5BrO3 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 5-bromo-4-oxochromene-3-carbaldehyde |
| InChIKey | CGVXSNLTRYHWLU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)C(=CO2)C=O |
Computed by PubChem (NCBI)