CAS 524916-42-5 appears in our catalog under these names: 2-Amino-5-(methoxycarbonyl)phenylboronic acid pinacol ester, 98%, Methyl 4–amino–3–(4，4，5，5–tetramethyl–1，3，2–dioxaborolan–2–yl)benzoate, Methyl 4-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
Methyl 4-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 524916-42-5) is a chemical compound with the molecular formula C14H20BNO4 and a molecular weight of 277.13 g/mol. IUPAC name: methyl 4-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: MJOQXIXZHYEHQH-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO4 |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | methyl 4-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | MJOQXIXZHYEHQH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)OC)N |
Computed by PubChem (NCBI)