CAS 524956-02-3 appears in our catalog under these names: 3-Chloro-5-Nitro-1H-Indole, 3-Chloro-5-nitroindole, ≥97%, ≥97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
3-chloro-5-nitro-1H-indole (CAS 524956-02-3) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 3-chloro-5-nitro-1H-indole. InChIKey: VFIAOMIKIHVUKN-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 3-chloro-5-nitro-1H-indole |
| InChIKey | VFIAOMIKIHVUKN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=CN2)Cl |
Computed by PubChem (NCBI)