CAS 5262-25-9 is the registry number for 5-(Bromomethyl)-3-(4-fluorophenyl)isoxazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(bromomethyl)-3-(4-fluorophenyl)-1,2-oxazole (CAS 5262-25-9) is a chemical compound with the molecular formula C10H7BrFNO and a molecular weight of 256.07 g/mol. IUPAC name: 5-(bromomethyl)-3-(4-fluorophenyl)-1,2-oxazole. InChIKey: KTDCTRAYVOBOLV-UHFFFAOYSA-N.
| Molecular formula | C10H7BrFNO |
|---|---|
| Molecular weight | 256.07 g/mol |
| IUPAC name | 5-(bromomethyl)-3-(4-fluorophenyl)-1,2-oxazole |
| InChIKey | KTDCTRAYVOBOLV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2)CBr)F |
Computed by PubChem (NCBI)