CAS 52644-22-1 appears in our catalog under these names: 2-Phenylpyrimidine-4,6-diamine, 97%, 2-Phenylpyrimidine-4,6-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-phenylpyrimidine-4,6-diamine (CAS 52644-22-1) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 2-phenylpyrimidine-4,6-diamine. InChIKey: AXRVXGHNQKBQGF-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-phenylpyrimidine-4,6-diamine |
| InChIKey | AXRVXGHNQKBQGF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CC(=N2)N)N |
Computed by PubChem (NCBI)