CAS 52758-05-1 appears in our catalog under these names: Sertraline EP Impurity B HCl, Sertraline Impurity 2(Sertraline EP Impurity B), rac-cis-3,4-Deschlorosertraline, >95% (HPLC), (1RS,4RS)-N-Methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine Hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(1S,4S)-N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 52758-05-1) is a chemical compound with the molecular formula C17H20ClN and a molecular weight of 273.8 g/mol. IUPAC name: (1S,4S)-N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: XTSOELQVDLSJFM-RVXRQPKJSA-N.
| Molecular formula | C17H20ClN |
|---|---|
| Molecular weight | 273.8 g/mol |
| IUPAC name | (1S,4S)-N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | XTSOELQVDLSJFM-RVXRQPKJSA-N |
| SMILES | CN[C@H]1CC[C@H](C2=CC=CC=C12)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)