CAS 55056-87-6 is the registry number for (1S,4S)-N-Methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
(1S,4S)-N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 55056-87-6) is a chemical compound with the molecular formula C17H20ClN and a molecular weight of 273.8 g/mol. IUPAC name: (1S,4S)-N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: XTSOELQVDLSJFM-RVXRQPKJSA-N.
| Molecular formula | C17H20ClN |
|---|---|
| Molecular weight | 273.8 g/mol |
| IUPAC name | (1S,4S)-N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | XTSOELQVDLSJFM-RVXRQPKJSA-N |
| SMILES | CN[C@H]1CC[C@H](C2=CC=CC=C12)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)