Products 63675-71-8

CAS 63675-71-8 is the registry number for 4,4-Diphenylpiperidine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

4,4-diphenylpiperidine;hydrochloride (CAS 63675-71-8) is a chemical compound with the molecular formula C17H20ClN and a molecular weight of 273.8 g/mol. IUPAC name: 4,4-diphenylpiperidine;hydrochloride. InChIKey: VHBVKKWTZYRNHX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20ClN
Molecular weight273.8 g/mol
IUPAC name4,4-diphenylpiperidine;hydrochloride
InChIKeyVHBVKKWTZYRNHX-UHFFFAOYSA-N
SMILESC1CNCCC1(C2=CC=CC=C2)C3=CC=CC=C3.Cl

Computed by PubChem (NCBI)