Products 527681-33-0
CAS 527681-33-0 appears in our catalog under these names: Chroman-7-carboxylic Acid, Chroman–7–carboxylic acid, Chroman-7-carboxylic acid 95%, Chroman-7-carboxylic acid, 95%, 95%, Chroman-7-carboxylic acid, 98%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3,4-dihydro-2H-chromene-7-carboxylic acid (CAS 527681-33-0) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 3,4-dihydro-2H-chromene-7-carboxylic acid. InChIKey: PMBKBKXGTAPJGU-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 3,4-dihydro-2H-chromene-7-carboxylic acid |
| InChIKey | PMBKBKXGTAPJGU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)C(=O)O)OC1 |
Computed by PubChem (NCBI)