CAS 5278-38-6 appears in our catalog under these names: 6,7-Dimethoxycarbostyril, 95%, 6,7-Dimethoxycarbostyril. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg, 5000mg.
6,7-dimethoxy-1H-quinolin-2-one (CAS 5278-38-6) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 6,7-dimethoxy-1H-quinolin-2-one. InChIKey: YCIOUNSWHDKEBM-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 6,7-dimethoxy-1H-quinolin-2-one |
| InChIKey | YCIOUNSWHDKEBM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CC(=O)N2)OC |
Computed by PubChem (NCBI)