CAS 52845-68-8 appears in our catalog under these names: 1-(3-Chloro-4-methylphenyl)-1h-pyrrole-2,5-dione, 95%, 1-(3-Chloro-4-methylphenyl)-1H-pyrrole-2,5-dione, 95+%, 1-(3-Chloro-4-methylphenyl)-1H-pyrrole-2,5-dione, 98%, 98%, 1-(3-chloro-4-methylphenyl)-1H-pyrrole-2,5-dione. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 25g.
1-(3-chloro-4-methylphenyl)pyrrole-2,5-dione (CAS 52845-68-8) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: 1-(3-chloro-4-methylphenyl)pyrrole-2,5-dione. InChIKey: XZEWOPDHALLILR-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 1-(3-chloro-4-methylphenyl)pyrrole-2,5-dione |
| InChIKey | XZEWOPDHALLILR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=O)C=CC2=O)Cl |
Computed by PubChem (NCBI)