CAS 52913-14-1 appears in our catalog under these names: o-Tosylhydroxylamine, O–(p–Tolylsulfonyl)hydroxylamine. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 25mg.
Amino 4-methylbenzenesulfonate (CAS 52913-14-1) is a chemical compound with the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. IUPAC name: amino 4-methylbenzenesulfonate. InChIKey: OAIJQSLFIIMPOI-UHFFFAOYSA-N.
| Molecular formula | C7H9NO3S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | amino 4-methylbenzenesulfonate |
| InChIKey | OAIJQSLFIIMPOI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)ON |
Computed by PubChem (NCBI)