CAS 52943-21-2 appears in our catalog under these names: 2-Chloro-n,n-dimethylnicotinamide, 95%, 2-Chloro-N,N-dimethylnicotinamide, 97% , 2-Chloro-N,N-dimethylnicotinamide 95%, 2-chloro-N,N-dimethylnicotinamide, 97%, 2-Chloro-N,N-dimethylnicotinamide, 95%, 95%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 5g, 1g, 10g, 25g.
2-chloro-N,N-dimethylpyridine-3-carboxamide (CAS 52943-21-2) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 2-chloro-N,N-dimethylpyridine-3-carboxamide. InChIKey: QNZRJGJNLOMEGJ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 2-chloro-N,N-dimethylpyridine-3-carboxamide |
| InChIKey | QNZRJGJNLOMEGJ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(N=CC=C1)Cl |
Computed by PubChem (NCBI)