Products 530-35-8
CAS 530-35-8 is the registry number for Etafedrine Hydrochloride. Offered by: Mikromol, LoGiCal. Available pack sizes: 100mg, 10mg.
(1R,2S)-2-[ethyl(methyl)amino]-1-phenylpropan-1-ol;hydrochloride (CAS 530-35-8) is a chemical compound with the molecular formula C12H20ClNO and a molecular weight of 229.74 g/mol. IUPAC name: (1R,2S)-2-[ethyl(methyl)amino]-1-phenylpropan-1-ol;hydrochloride. InChIKey: WRONACHIHQGZSD-JGAZGGJJSA-N.
| Molecular formula | C12H20ClNO |
|---|---|
| Molecular weight | 229.74 g/mol |
| IUPAC name | (1R,2S)-2-[ethyl(methyl)amino]-1-phenylpropan-1-ol;hydrochloride |
| InChIKey | WRONACHIHQGZSD-JGAZGGJJSA-N |
| SMILES | CCN(C)[C@@H](C)[C@@H](C1=CC=CC=C1)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
Etafedrine hydrochloride, Nethamine, Etafedrine HCl, Etafedrin hydrochloride, Etafedrine hydrochloride, (-)-, Benzenemethanol, alpha-(1-(ethylmethylamino)ethyl)-, hydrochloride, (-)-ethylephedrine hydrochloride, Etafedrine hydrochloride [USAN], Menetyl, Benzenemethanol, alpha-[1-(ethylmethylamino)ethyl]-, hydrochloride, [R-(R*,S*)]-