CAS 530080-21-8 is the registry number for 1-(4-Bromo-2-fluorophenyl)-1H-1,2,3,4-tetrazole. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(4-bromo-2-fluorophenyl)tetrazole (CAS 530080-21-8) is a chemical compound with the molecular formula C7H4BrFN4 and a molecular weight of 243.04 g/mol. IUPAC name: 1-(4-bromo-2-fluorophenyl)tetrazole. InChIKey: STLVTUYTSUKTSC-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN4 |
|---|---|
| Molecular weight | 243.04 g/mol |
| IUPAC name | 1-(4-bromo-2-fluorophenyl)tetrazole |
| InChIKey | STLVTUYTSUKTSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)N2C=NN=N2 |
Computed by PubChem (NCBI)