CAS 530081-35-7 appears in our catalog under these names: 5–(4–Bromo–2–fluorophenyl)–2H–tetrazole, 5-(4-Bromo-2-fluorophenyl)-2H-tetrazole. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
5-(4-bromo-2-fluorophenyl)-2H-tetrazole (CAS 530081-35-7) is a chemical compound with the molecular formula C7H4BrFN4 and a molecular weight of 243.04 g/mol. IUPAC name: 5-(4-bromo-2-fluorophenyl)-2H-tetrazole. InChIKey: CPNRPKDPUSJSTG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN4 |
|---|---|
| Molecular weight | 243.04 g/mol |
| IUPAC name | 5-(4-bromo-2-fluorophenyl)-2H-tetrazole |
| InChIKey | CPNRPKDPUSJSTG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C2=NNN=N2 |
Computed by PubChem (NCBI)