CAS 870562-41-7 appears in our catalog under these names: 5–(2–Bromo–5–Fluorophenyl)–2H–1,2,3,4–Tetrazole, 5-(2-Bromo-5-fluorophenyl)-2H-1,2,3,4-tetrazole, 5-(2-bromo-5-fluorophenyl)-2H-1,2,3,4-tetrazole, 97%, 97%, 5-(2-Bromo-5-fluorophenyl)-2h-1,2,3,4-tetrazole, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 2,5g.
5-(2-bromo-5-fluorophenyl)-2H-tetrazole (CAS 870562-41-7) is a chemical compound with the molecular formula C7H4BrFN4 and a molecular weight of 243.04 g/mol. IUPAC name: 5-(2-bromo-5-fluorophenyl)-2H-tetrazole. InChIKey: VPZYFHKSBYJOFN-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN4 |
|---|---|
| Molecular weight | 243.04 g/mol |
| IUPAC name | 5-(2-bromo-5-fluorophenyl)-2H-tetrazole |
| InChIKey | VPZYFHKSBYJOFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C2=NNN=N2)Br |
Computed by PubChem (NCBI)