Products 53040-41-8
CAS 53040-41-8 is the registry number for Ethyl 3-((4-chlorophenyl)amino)-5-methyl-2,4-thiazolecarboxylate. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg.
Ethyl 2-(4-chloroanilino)-4-methyl-1,3-thiazole-5-carboxylate (CAS 53040-41-8) is a chemical compound with the molecular formula C13H13ClN2O2S and a molecular weight of 296.77 g/mol. IUPAC name: ethyl 2-(4-chloroanilino)-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: QFQVBSSONVIBFL-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2S |
|---|---|
| Molecular weight | 296.77 g/mol |
| IUPAC name | ethyl 2-(4-chloroanilino)-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | QFQVBSSONVIBFL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)NC2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)