CAS 53060-59-6 is the registry number for (+)-alfa-Barbatene. Offered by: Chemat Brand. Available pack sizes: on request.
(+)-alpha-barbatene is a carbotricyclic compound and sesquiterpene that is 1,2,3,3a,4,5,8,8a-octahydro-4,8-methanoazulene that is substituted by methyl groups at the 3a, 4, 7 and 8a positions (the 3aR,4R,8R,8aS-diastereoisomer). It is a sesquiterpene and a carbotricyclic compound.
Source: ChEBI
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1R,2R,6S,7R)-1,2,6,8-tetramethyltricyclo[5.3.1.02,6]undec-8-ene |
| InChIKey | RMKQBFUAKZOVPQ-APIJFGDWSA-N |
| SMILES | CC1=CC[C@@]2(C[C@H]1[C@]3([C@@]2(CCC3)C)C)C |
Computed by PubChem (NCBI)