CAS 53065-22-8 is the registry number for 2-Hydrazinyl-5,6-dimethylbenzo(d)thiazole, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
(5,6-dimethyl-1,3-benzothiazol-2-yl)hydrazine (CAS 53065-22-8) is a chemical compound with the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. IUPAC name: (5,6-dimethyl-1,3-benzothiazol-2-yl)hydrazine. InChIKey: QNPPOSLNDDRPTR-UHFFFAOYSA-N.
| Molecular formula | C9H11N3S |
|---|---|
| Molecular weight | 193.27 g/mol |
| IUPAC name | (5,6-dimethyl-1,3-benzothiazol-2-yl)hydrazine |
| InChIKey | QNPPOSLNDDRPTR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)SC(=N2)NN |
Computed by PubChem (NCBI)