CAS 53076-59-8 is the registry number for 6,8-Dimethoxyl-2-tetralone. Offered by: TRC. Available pack sizes: 750mg.
6,8-dimethoxy-3,4-dihydro-1H-naphthalen-2-one (CAS 53076-59-8) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 6,8-dimethoxy-3,4-dihydro-1H-naphthalen-2-one. InChIKey: SIIBOHMMQGFEPX-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 6,8-dimethoxy-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | SIIBOHMMQGFEPX-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(=O)CC2)C(=C1)OC |
Computed by PubChem (NCBI)