Products 5309-50-2

CAS 5309-50-2 is the registry number for Diethyl 2-allyl-2-(2-methylallyl)malonate. Offered by: Biosynth. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g.

Structural formula: {0} (CAS {1})

Diethyl 2-(2-methylprop-2-enyl)-2-prop-2-enylpropanedioate (CAS 5309-50-2) is a chemical compound with the molecular formula C14H22O4 and a molecular weight of 254.32 g/mol. IUPAC name: diethyl 2-(2-methylprop-2-enyl)-2-prop-2-enylpropanedioate. InChIKey: SBCXXCUHJQSEFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22O4
Molecular weight254.32 g/mol
IUPAC namediethyl 2-(2-methylprop-2-enyl)-2-prop-2-enylpropanedioate
InChIKeySBCXXCUHJQSEFQ-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC=C)(CC(=C)C)C(=O)OCC

Computed by PubChem (NCBI)