CAS 53271-21-9 is the registry number for 1-Chloro-2-nitro-4-(phenylmethyl)benzene. Offered by: TRC. Available pack sizes: 1g.
4-benzyl-1-chloro-2-nitrobenzene (CAS 53271-21-9) is a chemical compound with the molecular formula C13H10ClNO2 and a molecular weight of 247.67 g/mol. IUPAC name: 4-benzyl-1-chloro-2-nitrobenzene. InChIKey: FFEYAWAZZHNKIS-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO2 |
|---|---|
| Molecular weight | 247.67 g/mol |
| IUPAC name | 4-benzyl-1-chloro-2-nitrobenzene |
| InChIKey | FFEYAWAZZHNKIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)