CAS 53292-54-9 is the registry number for N-(2,6-Dichlorophenyl)-1-ethyl-4,5-dihydro-1H-imidazol-2-amine, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg.
N'-hydroxy-3-(trifluoromethoxy)benzenecarboximidamide (CAS 53292-54-9) is a chemical compound with the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. IUPAC name: N'-hydroxy-3-(trifluoromethoxy)benzenecarboximidamide. InChIKey: GDEBBTWHSBXNJB-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O2 |
|---|---|
| Molecular weight | 220.15 g/mol |
| IUPAC name | N'-hydroxy-3-(trifluoromethoxy)benzenecarboximidamide |
| InChIKey | GDEBBTWHSBXNJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)/C(=N/O)/N |
Computed by PubChem (NCBI)