CAS 53292-89-0 appears in our catalog under these names: Boc-trans-4-aminocyclohexanecarboxylic acid, >95% (HPLC), trans–4–(tert–butoxycarbonylamino)cyclohexanecarboxylic acid, Boc-1,4-trans-ACHC-OH, trans-4-(tert-Butoxycarbonylamino)cyclohexanecarboxylic Acid, >98.0%(GC)(T), Boc-trans-4-aminocyclohexanecarboxylic acid 98%. Offered by: TRC, GLPBio, Iris Biotech, TCI, Ambeed. Available pack sizes: 500mg, 25g, 5g, 1g, 10g, 100g, 500g, 50g.
4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 53292-89-0) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: KXMRDHPZQHAXML-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | KXMRDHPZQHAXML-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)C(=O)O |
Computed by PubChem (NCBI)