CAS 532966-59-9 appears in our catalog under these names: 4-(tert-Butyl)-3-hydroxybenzaldehyde, 95%, 4-(tert-Butyl)-3-hydroxybenzaldehyde. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 50mg.
4-tert-butyl-3-hydroxybenzaldehyde (CAS 532966-59-9) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 4-tert-butyl-3-hydroxybenzaldehyde. InChIKey: FSVIZUKIXXXTAE-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 4-tert-butyl-3-hydroxybenzaldehyde |
| InChIKey | FSVIZUKIXXXTAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C=C1)C=O)O |
Computed by PubChem (NCBI)