CAS 532987-11-4 is the registry number for Clopidogrel Impurity 32. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-amino-2-(3-chlorophenyl)acetate (CAS 532987-11-4) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: methyl 2-amino-2-(3-chlorophenyl)acetate. InChIKey: MXKXDSBRKXFPGE-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | methyl 2-amino-2-(3-chlorophenyl)acetate |
| InChIKey | MXKXDSBRKXFPGE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=CC=C1)Cl)N |
Computed by PubChem (NCBI)