CAS 5334-43-0 appears in our catalog under these names: 5–amino–1–phenyl–1H–pyrazole–4–carbonitrile, 5-Amino-1-phenyl-1H-pyrazole-4-carbonitrile, 95%, 95%, 5-Amino-1-phenyl-1H-pyrazole-4-carbonitrile, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
5-amino-1-phenylpyrazole-4-carbonitrile (CAS 5334-43-0) is a chemical compound with the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. IUPAC name: 5-amino-1-phenylpyrazole-4-carbonitrile. InChIKey: MAKQREKUUHPPIS-UHFFFAOYSA-N.
| Molecular formula | C10H8N4 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 5-amino-1-phenylpyrazole-4-carbonitrile |
| InChIKey | MAKQREKUUHPPIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=C(C=N2)C#N)N |
Computed by PubChem (NCBI)