CAS 53515-23-4 appears in our catalog under these names: 3-Bromo-4-(4-methylphenyl)-4-oxobutanoic acid, 3-Bromo-4-oxo-4-(p-tolyl)butanoic acid, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 10g.
3-bromo-4-(4-methylphenyl)-4-oxobutanoic acid (CAS 53515-23-4) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: 3-bromo-4-(4-methylphenyl)-4-oxobutanoic acid. InChIKey: AFLMNHCSODTMON-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | 3-bromo-4-(4-methylphenyl)-4-oxobutanoic acid |
| InChIKey | AFLMNHCSODTMON-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(CC(=O)O)Br |
Computed by PubChem (NCBI)