CAS 53581-82-1 appears in our catalog under these names: 2,5-Dimethoxy-4-(1-methylethyl)benzaldehyde, 4-Isopropyl-2,5-dimethoxybenzaldehyde, 98%. Offered by: TRC, Chemat Brand. Available pack sizes: 1g, on request.
2,5-dimethoxy-4-propan-2-ylbenzaldehyde (CAS 53581-82-1) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2,5-dimethoxy-4-propan-2-ylbenzaldehyde. InChIKey: RVVOAJNVARQGQW-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 2,5-dimethoxy-4-propan-2-ylbenzaldehyde |
| InChIKey | RVVOAJNVARQGQW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=C(C(=C1)OC)C=O)OC |
Computed by PubChem (NCBI)