Products 53600-12-7
CAS 53600-12-7 is the registry number for Ethyl 2-methyl-1H-indole-5-carboxylate, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 50mg.
Ethyl 2-methyl-1H-indole-5-carboxylate (CAS 53600-12-7) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: ethyl 2-methyl-1H-indole-5-carboxylate. InChIKey: YFKMUHCEYGQEJA-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | ethyl 2-methyl-1H-indole-5-carboxylate |
| InChIKey | YFKMUHCEYGQEJA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)NC(=C2)C |
Computed by PubChem (NCBI)