CAS 536742-64-0 is the registry number for 1-(4-Bromophenyl)-3-pyrrolidinol. Offered by: TRC, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(4-bromophenyl)pyrrolidin-3-ol (CAS 536742-64-0) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: 1-(4-bromophenyl)pyrrolidin-3-ol. InChIKey: VXAGQCJOIGKVLU-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | 1-(4-bromophenyl)pyrrolidin-3-ol |
| InChIKey | VXAGQCJOIGKVLU-UHFFFAOYSA-N |
| SMILES | C1CN(CC1O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)