CAS 536748-05-7 appears in our catalog under these names: 3-Fluoro-N,N-dimethyl-4-nitrobenzamide, 95%, 3-Fluoro-N,N-dimethyl-4-nitrobenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-fluoro-N,N-dimethyl-4-nitrobenzamide (CAS 536748-05-7) is a chemical compound with the molecular formula C9H9FN2O3 and a molecular weight of 212.18 g/mol. IUPAC name: 3-fluoro-N,N-dimethyl-4-nitrobenzamide. InChIKey: KHNPKPIOPWXLRU-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O3 |
|---|---|
| Molecular weight | 212.18 g/mol |
| IUPAC name | 3-fluoro-N,N-dimethyl-4-nitrobenzamide |
| InChIKey | KHNPKPIOPWXLRU-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)