CAS 53690-44-1 is the registry number for Methyl[(1s)-1-phenylethyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
(1S)-N-methyl-1-phenylethanamine;hydrochloride (CAS 53690-44-1) is a chemical compound with the molecular formula C9H14ClN and a molecular weight of 171.67 g/mol. IUPAC name: (1S)-N-methyl-1-phenylethanamine;hydrochloride. InChIKey: CLMUXERMQYHMJN-QRPNPIFTSA-N.
| Molecular formula | C9H14ClN |
|---|---|
| Molecular weight | 171.67 g/mol |
| IUPAC name | (1S)-N-methyl-1-phenylethanamine;hydrochloride |
| InChIKey | CLMUXERMQYHMJN-QRPNPIFTSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)NC.Cl |
Computed by PubChem (NCBI)