CAS 53773-76-5 is the registry number for 4'-Methoxy-2'-methylpropiophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-(4-methoxy-2-methylphenyl)propan-1-one (CAS 53773-76-5) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 1-(4-methoxy-2-methylphenyl)propan-1-one. InChIKey: UOYQXLFNCLUVBD-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 1-(4-methoxy-2-methylphenyl)propan-1-one |
| InChIKey | UOYQXLFNCLUVBD-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=C(C=C1)OC)C |
Computed by PubChem (NCBI)