CAS 5378-76-7 appears in our catalog under these names: 3-Methyl-5-nitrobenzene-1,2-diol, 95%, 3-Methyl-5-nitrocatechol. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 2g, 5g, 10g.
3-methyl-5-nitrobenzene-1,2-diol (CAS 5378-76-7) is a chemical compound with the molecular formula C7H7NO4 and a molecular weight of 169.13 g/mol. IUPAC name: 3-methyl-5-nitrobenzene-1,2-diol. InChIKey: VZDSEMYVKHLPLX-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 3-methyl-5-nitrobenzene-1,2-diol |
| InChIKey | VZDSEMYVKHLPLX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)