CAS 538367-60-1 appears in our catalog under these names: 4-Formyl-3,5-dimethylbenzoic acid, 95%, 4-Formyl-3,5-dimethylbenzoic acid, 98%, 4-Formyl-3,5-dimethylbenzoic acid, 4-Formyl-3,5-dimethylbenzoic acid 95%, 4-Formyl-3,5-dimethylbenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g, 50mg, 100mg.
4-formyl-3,5-dimethylbenzoic acid (CAS 538367-60-1) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4-formyl-3,5-dimethylbenzoic acid. InChIKey: VJSOYWONAPNDHC-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4-formyl-3,5-dimethylbenzoic acid |
| InChIKey | VJSOYWONAPNDHC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C=O)C)C(=O)O |
Computed by PubChem (NCBI)