Products 53859-06-6
CAS 53859-06-6 appears in our catalog under these names: Desoxo–narchinol A, Desoxo-narchinol A, Desoxo-Narchinol A, ≥98%, ≥98%, Desoxo-narchinol A, 98.0%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 20mg, 1 mg, 5 mg.
(4R,4aS,5R)-4-hydroxy-4a,5-dimethyl-4,5,6,7-tetrahydronaphthalen-1-one (CAS 53859-06-6) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: (4R,4aS,5R)-4-hydroxy-4a,5-dimethyl-4,5,6,7-tetrahydronaphthalen-1-one. InChIKey: YWSIMWUTQXMOSD-FXAINCCUSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | (4R,4aS,5R)-4-hydroxy-4a,5-dimethyl-4,5,6,7-tetrahydronaphthalen-1-one |
| InChIKey | YWSIMWUTQXMOSD-FXAINCCUSA-N |
| SMILES | C[C@@H]1CCC=C2[C@]1([C@@H](C=CC2=O)O)C |
Computed by PubChem (NCBI)