Products 53859-07-7
CAS 53859-07-7 is the registry number for 2-Deoxokanshone M. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4aS,5R)-4a,5-dimethyl-4,5,6,7-tetrahydronaphthalene-1,3-dione (CAS 53859-07-7) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: (4aS,5R)-4a,5-dimethyl-4,5,6,7-tetrahydronaphthalene-1,3-dione. InChIKey: QBWXJIDMACMDQA-PELKAZGASA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | (4aS,5R)-4a,5-dimethyl-4,5,6,7-tetrahydronaphthalene-1,3-dione |
| InChIKey | QBWXJIDMACMDQA-PELKAZGASA-N |
| SMILES | C[C@@H]1CCC=C2[C@]1(CC(=O)CC2=O)C |
Computed by PubChem (NCBI)
Synonyms:
2-Deoxokanshone M, orb2564267