CAS 53903-49-4 appears in our catalog under these names: 4–Methoxy–2–(trifluoromethyl)aniline, 4-Methoxy-2-(trifluoromethyl)aniline, 4-Methoxy-2-(trifluoromethyl)aniline 98%, 4-Methoxy-2-(trifluoromethyl)aniline, 98%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 50g, 10g, 100g, 1g.
4-methoxy-2-(trifluoromethyl)aniline (CAS 53903-49-4) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: 4-methoxy-2-(trifluoromethyl)aniline. InChIKey: BTRQZDUCUGJMPS-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 4-methoxy-2-(trifluoromethyl)aniline |
| InChIKey | BTRQZDUCUGJMPS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)