Products 53946-00-2

CAS 53946-00-2 is the registry number for N-Hydroxy-1-naphthimidoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(1Z)-N-hydroxynaphthalene-1-carboximidoyl chloride (CAS 53946-00-2) is a chemical compound with the molecular formula C11H8ClNO and a molecular weight of 205.64 g/mol. IUPAC name: (1Z)-N-hydroxynaphthalene-1-carboximidoyl chloride. InChIKey: VDSBIVTXOOTQIP-QBFSEMIESA-N.

Identity
Molecular formulaC11H8ClNO
Molecular weight205.64 g/mol
IUPAC name(1Z)-N-hydroxynaphthalene-1-carboximidoyl chloride
InChIKeyVDSBIVTXOOTQIP-QBFSEMIESA-N
SMILESC1=CC=C2C(=C1)C=CC=C2/C(=N/O)/Cl

Computed by PubChem (NCBI)