CAS 53946-00-2 is the registry number for N-Hydroxy-1-naphthimidoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1Z)-N-hydroxynaphthalene-1-carboximidoyl chloride (CAS 53946-00-2) is a chemical compound with the molecular formula C11H8ClNO and a molecular weight of 205.64 g/mol. IUPAC name: (1Z)-N-hydroxynaphthalene-1-carboximidoyl chloride. InChIKey: VDSBIVTXOOTQIP-QBFSEMIESA-N.
| Molecular formula | C11H8ClNO |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | (1Z)-N-hydroxynaphthalene-1-carboximidoyl chloride |
| InChIKey | VDSBIVTXOOTQIP-QBFSEMIESA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2/C(=N/O)/Cl |
Computed by PubChem (NCBI)