CAS 53948-38-2 is the registry number for 2,4-dibromo-6-ethoxyphenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4-dibromo-6-ethoxyphenol (CAS 53948-38-2) is a chemical compound with the molecular formula C8H8Br2O2 and a molecular weight of 295.96 g/mol. IUPAC name: 2,4-dibromo-6-ethoxyphenol. InChIKey: QBNRBDGATBKBPY-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2O2 |
|---|---|
| Molecular weight | 295.96 g/mol |
| IUPAC name | 2,4-dibromo-6-ethoxyphenol |
| InChIKey | QBNRBDGATBKBPY-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)Br)Br)O |
Computed by PubChem (NCBI)