CAS 53948-51-9 appears in our catalog under these names: Bisnortilidine (1mg/ml in Acetonitrile), Bisnortilidine. Offered by: TRC, Biosynth. Available pack sizes: 10x1ml, 10mg, 25mg, 5mg, 50mg, 100mg.
Ethyl (1S,2R)-2-amino-1-phenylcyclohex-3-ene-1-carboxylate (CAS 53948-51-9) is a chemical compound with the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. IUPAC name: ethyl (1S,2R)-2-amino-1-phenylcyclohex-3-ene-1-carboxylate. InChIKey: BTKAMSWFNMGLGM-HIFRSBDPSA-N.
| Molecular formula | C15H19NO2 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | ethyl (1S,2R)-2-amino-1-phenylcyclohex-3-ene-1-carboxylate |
| InChIKey | BTKAMSWFNMGLGM-HIFRSBDPSA-N |
| SMILES | CCOC(=O)[C@@]1(CCC=C[C@H]1N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)