CAS 5397-37-5 appears in our catalog under these names: 3-Nitrofluorene, 3-Nitrofluorene 95%. Offered by: TRC, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
3-nitro-9H-fluorene (CAS 5397-37-5) is a chemical compound with the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. IUPAC name: 3-nitro-9H-fluorene. InChIKey: CKAGNBSBBQJLCI-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 3-nitro-9H-fluorene |
| InChIKey | CKAGNBSBBQJLCI-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)[N+](=O)[O-])C3=CC=CC=C31 |
Computed by PubChem (NCBI)