Products 539790-90-4

CAS 539790-90-4 is the registry number for Dimethoxydi(pent-4-en-1-yl)silane 98% (stabilized with TBC). Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Dimethoxy-bis(pent-4-enyl)silane (CAS 539790-90-4) is a chemical compound with the molecular formula C12H24O2Si and a molecular weight of 228.40 g/mol. IUPAC name: dimethoxy-bis(pent-4-enyl)silane. InChIKey: WHDKFEKXPUEZAD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24O2Si
Molecular weight228.40 g/mol
IUPAC namedimethoxy-bis(pent-4-enyl)silane
InChIKeyWHDKFEKXPUEZAD-UHFFFAOYSA-N
SMILESCO[Si](CCCC=C)(CCCC=C)OC

Computed by PubChem (NCBI)