CAS 74173-08-3 appears in our catalog under these names: 2-(tert-Butyldimethylsilyloxy)cyclohexanone, 95%, 2-((tert-Butyldimethylsilyl)oxy)cyclohexanone, 97%, 2–(tert–ButyldiMethylsilyloxy)cyclohexanone. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 10g, 1g, 5g.
2-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-one (CAS 74173-08-3) is a chemical compound with the molecular formula C12H24O2Si and a molecular weight of 228.40 g/mol. IUPAC name: 2-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-one. InChIKey: HOZXDUOXGSOLJB-UHFFFAOYSA-N.
| Molecular formula | C12H24O2Si |
|---|---|
| Molecular weight | 228.40 g/mol |
| IUPAC name | 2-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-one |
| InChIKey | HOZXDUOXGSOLJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCCC1=O |
Computed by PubChem (NCBI)