CAS 939411-89-9 is the registry number for 2-{1-((tert-Butyldimethylsilyl)oxy)cyclobutyl}acetaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[1-[tert-butyl(dimethyl)silyl]oxycyclobutyl]acetaldehyde (CAS 939411-89-9) is a chemical compound with the molecular formula C12H24O2Si and a molecular weight of 228.40 g/mol. IUPAC name: 2-[1-[tert-butyl(dimethyl)silyl]oxycyclobutyl]acetaldehyde. InChIKey: NAHGSTDYJQAXNQ-UHFFFAOYSA-N.
| Molecular formula | C12H24O2Si |
|---|---|
| Molecular weight | 228.40 g/mol |
| IUPAC name | 2-[1-[tert-butyl(dimethyl)silyl]oxycyclobutyl]acetaldehyde |
| InChIKey | NAHGSTDYJQAXNQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1(CCC1)CC=O |
Computed by PubChem (NCBI)