Products 5398-79-8
CAS 5398-79-8 appears in our catalog under these names: (2,5-Dichlorophenyl)acetic acid, Benzeneacetic acid, 2,5-dichloro-, 98%, 98%, 2-(2,5-Dichlorophenyl)acetic acid, 98%, 2-(2,5-Dichlorophenyl)acetic acid, 95%, Benzeneacetic acid, 2,5-dichloro-, 98%. Offered by: Biosynth, Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 50g, 25g, 100g, 100mg, 250mg, 1g, 5g, 10g.
2-(2,5-dichlorophenyl)acetic acid (CAS 5398-79-8) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)acetic acid. InChIKey: GWTUGCOXTFFBMM-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)acetic acid |
| InChIKey | GWTUGCOXTFFBMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CC(=O)O)Cl |
Computed by PubChem (NCBI)