CAS 53984-98-8 is the registry number for 2-Cyano-n-(2,6-dimethylphenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-cyano-N-(2,6-dimethylphenyl)acetamide (CAS 53984-98-8) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 2-cyano-N-(2,6-dimethylphenyl)acetamide. InChIKey: VIUNSIQTGADORL-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 2-cyano-N-(2,6-dimethylphenyl)acetamide |
| InChIKey | VIUNSIQTGADORL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CC#N |
Computed by PubChem (NCBI)