CAS 54030-51-2 appears in our catalog under these names: 2-Mercapto-6,7-dimethyl-pteridin-4-ol, HIV-1 integrase inhibitor 11. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 1g, 500mg, 100 mg, 1 g, 500 mg.
6,7-dimethyl-2-sulfanylidene-1H-pteridin-4-one (CAS 54030-51-2) is a chemical compound with the molecular formula C8H8N4OS and a molecular weight of 208.24 g/mol. IUPAC name: 6,7-dimethyl-2-sulfanylidene-1H-pteridin-4-one. InChIKey: FMPVXDGAZOSEMT-UHFFFAOYSA-N.
| Molecular formula | C8H8N4OS |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 6,7-dimethyl-2-sulfanylidene-1H-pteridin-4-one |
| InChIKey | FMPVXDGAZOSEMT-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C(=N1)C(=O)NC(=S)N2)C |
Computed by PubChem (NCBI)